C19H23BrO6 — CID 12987032
(2S,3S,4aS,8R,8aR)-6-bromo-2,3-dimethoxy-2,3-dimethyl-8-phenylmethoxy-8,8a-dihydro-4aH-1,4-benzodioxin-5-one (PubChem CID 12987032) has the molecular formula C19H23BrO6 and a molecular weight of 427.29 g/mol. Its IUPAC name is (2S,3S,4aS,8R,8aR)-6-bromo-2,3-dimethoxy-2,3-dimethyl-8-phenylmethoxy-8,8a-dihydro-4aH-1,4-benzodioxin-5-one.
| Compound Name | (2S,3S,4aS,8R,8aR)-6-bromo-2,3-dimethoxy-2,3-dimethyl-8-phenylmethoxy-8,8a-dihydro-4aH-1,4-benzodioxin-5-one |
|---|---|
| PubChem CID | 12987032 |
| Molecular Formula | C19H23BrO6 |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | (2S,3S,4aS,8R,8aR)-6-bromo-2,3-dimethoxy-2,3-dimethyl-8-phenylmethoxy-8,8a-dihydro-4aH-1,4-benzodioxin-5-one |
| SMILES | CO[C@@]1(C)O[C@H]2[C@H](O[C@]1(C)OC)C(=O)C(Br)=C[C@H]2OCc1ccccc1 |
| InChI | InChI=1S/C19H23BrO6/c1-18(22-3)19(2,23-4)26-17-15(21)13(20)10-14(16(17)25-18)24-11-12-8-6-5-7-9-12/h5-10,14,16-17H,11H2,1-4H3/t14-,16-,17-,18+,19+/m1/s1 |
| InChIKey | IDBCHSMJUJPXDL-DBDQLMEASA-N |
| XLogP | 2.94 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|