C18H24O3 — CID 22922457
1-methoxy-2,6,6-trimethyl-4-phenylmethoxy-8-oxabicyclo[3.2.1]oct-2-ene (PubChem CID 22922457) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-methoxy-2,6,6-trimethyl-4-phenylmethoxy-8-oxabicyclo[3.2.1]oct-2-ene.
| Compound Name | 1-methoxy-2,6,6-trimethyl-4-phenylmethoxy-8-oxabicyclo[3.2.1]oct-2-ene |
|---|---|
| PubChem CID | 22922457 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 1-methoxy-2,6,6-trimethyl-4-phenylmethoxy-8-oxabicyclo[3.2.1]oct-2-ene |
| SMILES | COC12CC(C)(C)C(O1)C(OCc1ccccc1)C=C2C |
| InChI | InChI=1S/C18H24O3/c1-13-10-15(20-11-14-8-6-5-7-9-14)16-17(2,3)12-18(13,19-4)21-16/h5-10,15-16H,11-12H2,1-4H3 |
| InChIKey | QAFGXBFGRSLCNM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|