C17H22O4 — CID 58798852
(3aS,4R,5S,7aR)-2,2,7-trimethyl-5-phenylmethoxy-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol (PubChem CID 58798852) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is (3aS,4R,5S,7aR)-2,2,7-trimethyl-5-phenylmethoxy-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol.
| Compound Name | (3aS,4R,5S,7aR)-2,2,7-trimethyl-5-phenylmethoxy-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol |
|---|---|
| PubChem CID | 58798852 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (3aS,4R,5S,7aR)-2,2,7-trimethyl-5-phenylmethoxy-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol |
| SMILES | CC1=C[C@H](OCc2ccccc2)[C@@H](O)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C17H22O4/c1-11-9-13(19-10-12-7-5-4-6-8-12)14(18)16-15(11)20-17(2,3)21-16/h4-9,13-16,18H,10H2,1-3H3/t13-,14+,15+,16-/m0/s1 |
| InChIKey | CKUQTLIMWKZMAI-JJXSEGSLSA-N |
| XLogP | 2.41 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|