C16H19ClO4 — CID 11120486
(3aS,4R,5S,7aS)-7-chloro-2,2-dimethyl-5-phenylmethoxy-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol (PubChem CID 11120486) has the molecular formula C16H19ClO4 and a molecular weight of 310.78 g/mol. Its IUPAC name is (3aS,4R,5S,7aS)-7-chloro-2,2-dimethyl-5-phenylmethoxy-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol.
| Compound Name | (3aS,4R,5S,7aS)-7-chloro-2,2-dimethyl-5-phenylmethoxy-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol |
|---|---|
| PubChem CID | 11120486 |
| Molecular Formula | C16H19ClO4 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | (3aS,4R,5S,7aS)-7-chloro-2,2-dimethyl-5-phenylmethoxy-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol |
| SMILES | CC1(C)O[C@H]2[C@H](O)[C@@H](OCc3ccccc3)C=C(Cl)[C@H]2O1 |
| InChI | InChI=1S/C16H19ClO4/c1-16(2)20-14-11(17)8-12(13(18)15(14)21-16)19-9-10-6-4-3-5-7-10/h3-8,12-15,18H,9H2,1-2H3/t12-,13+,14+,15-/m0/s1 |
| InChIKey | CXERRHGZEMWDRC-YJNKXOJESA-N |
| XLogP | 2.59 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |