C21H33NO6 — CID 58798873
(3aS,4R,5S,7aR)-5-[[(3aS,4R,5S,7aR)-4-hydroxy-2,2,7-trimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]-methylamino]-2,2,7-trimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol (PubChem CID 58798873) has the molecular formula C21H33NO6 and a molecular weight of 395.50 g/mol. Its IUPAC name is (3aS,4R,5S,7aR)-5-[[(3aS,4R,5S,7aR)-4-hydroxy-2,2,7-trimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]-methylamino]-2,2,7-trimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol.
| Compound Name | (3aS,4R,5S,7aR)-5-[[(3aS,4R,5S,7aR)-4-hydroxy-2,2,7-trimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]-methylamino]-2,2,7-trimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol |
|---|---|
| PubChem CID | 58798873 |
| Molecular Formula | C21H33NO6 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | (3aS,4R,5S,7aR)-5-[[(3aS,4R,5S,7aR)-4-hydroxy-2,2,7-trimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]-methylamino]-2,2,7-trimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol |
| SMILES | CC1=C[C@H](N(C)[C@H]2C=C(C)[C@H]3OC(C)(C)O[C@H]3[C@@H]2O)[C@@H](O)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C21H33NO6/c1-10-8-12(14(23)18-16(10)25-20(3,4)27-18)22(7)13-9-11(2)17-19(15(13)24)28-21(5,6)26-17/h8-9,12-19,23-24H,1-7H3/t12-,13-,14+,15+,16+,17+,18-,19-/m0/s1 |
| InChIKey | BGCBAAGYPOXTNI-ZYPGRWQASA-N |
| XLogP | 1.34 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|