C9H12BrClO3 — CID 134853657
(3aS,4S,5S,7aS)-7-bromo-5-chloro-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol (PubChem CID 134853657) has the molecular formula C9H12BrClO3 and a molecular weight of 283.55 g/mol. Its IUPAC name is (3aS,4S,5S,7aS)-7-bromo-5-chloro-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol.
| Compound Name | (3aS,4S,5S,7aS)-7-bromo-5-chloro-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol |
|---|---|
| PubChem CID | 134853657 |
| Molecular Formula | C9H12BrClO3 |
| Molecular Weight | 283.55 g/mol |
| Exact Mass | 281.97 |
| IUPAC Name | (3aS,4S,5S,7aS)-7-bromo-5-chloro-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol |
| SMILES | CC1(C)O[C@H]2[C@H](O)[C@@H](Cl)C=C(Br)[C@H]2O1 |
| InChI | InChI=1S/C9H12BrClO3/c1-9(2)13-7-4(10)3-5(11)6(12)8(7)14-9/h3,5-8,12H,1-2H3/t5-,6+,7+,8-/m0/s1 |
| InChIKey | KCUGPUXSCBFTGD-OSMVPFSASA-N |
| XLogP | 1.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.55 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|