C21H41BrO4Si2 — CID 11071047
[(3aR,4S,5S,7aS)-7-bromo-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11071047) has the molecular formula C21H41BrO4Si2 and a molecular weight of 493.63 g/mol. Its IUPAC name is [(3aR,4S,5S,7aS)-7-bromo-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,4S,5S,7aS)-7-bromo-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11071047 |
| Molecular Formula | C21H41BrO4Si2 |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | [(3aR,4S,5S,7aS)-7-bromo-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C=C(Br)[C@H]2O1 |
| InChI | InChI=1S/C21H41BrO4Si2/c1-19(2,3)27(9,10)25-15-13-14(22)16-18(24-21(7,8)23-16)17(15)26-28(11,12)20(4,5)6/h13,15-18H,1-12H3/t15-,16+,17+,18+/m0/s1 |
| InChIKey | DCGMTPHNTUBKKV-BSDSXHPESA-N |
| XLogP | 6.58 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|