C25H42O4Si2 — CID 11305775
[(3aR,4R,7Z,11R,11aR)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5,6,9,10-tetradehydro-3a,4,11,11a-tetrahydrocyclodeca[d][1,3]dioxol-11-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11305775) has the molecular formula C25H42O4Si2 and a molecular weight of 462.78 g/mol. Its IUPAC name is [(3aR,4R,7Z,11R,11aR)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5,6,9,10-tetradehydro-3a,4,11,11a-tetrahydrocyclodeca[d][1,3]dioxol-11-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,4R,7Z,11R,11aR)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5,6,9,10-tetradehydro-3a,4,11,11a-tetrahydrocyclodeca[d][1,3]dioxol-11-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11305775 |
| Molecular Formula | C25H42O4Si2 |
| Molecular Weight | 462.78 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | [(3aR,4R,7Z,11R,11aR)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5,6,9,10-tetradehydro-3a,4,11,11a-tetrahydrocyclodeca[d][1,3]dioxol-11-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)[C@H](O[Si](C)(C)C(C)(C)C)C#C/C=C\C#C[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H42O4Si2/c1-23(2,3)30(9,10)28-19-17-15-13-14-16-18-20(29-31(11,12)24(4,5)6)22-21(19)26-25(7,8)27-22/h13-14,19-22H,1-12H3/b14-13-/t19-,20+,21-,22-/m0/s1 |
| InChIKey | VFFHKJQNSNYTAK-YUDZJLGDSA-N |
| XLogP | 5.86 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.78 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|