C16H30O6Si — CID 11057127
(1S,2R,6R,8S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-4,4,10-trimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-ol (PubChem CID 11057127) has the molecular formula C16H30O6Si and a molecular weight of 346.50 g/mol. Its IUPAC name is (1S,2R,6R,8S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-4,4,10-trimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-ol.
| Compound Name | (1S,2R,6R,8S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-4,4,10-trimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-ol |
|---|---|
| PubChem CID | 11057127 |
| Molecular Formula | C16H30O6Si |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (1S,2R,6R,8S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-4,4,10-trimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-ol |
| SMILES | CC1(C)O[C@H]2O[C@H]3[C@H](OC(C)(O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C16H30O6Si/c1-14(2,3)23(7,8)22-12-10-9(20-16(12,6)17)11-13(18-10)21-15(4,5)19-11/h9-13,17H,1-8H3/t9-,10-,11+,12-,13+,16?/m0/s1 |
| InChIKey | PDXFMFUBYVTHQF-XTYQAYIYSA-N |
| XLogP | 2.36 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|