C12H20O6 — CID 101334742
[(1R,2S,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-9-yl]methanol (PubChem CID 101334742) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is [(1R,2S,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-9-yl]methanol.
| Compound Name | [(1R,2S,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-9-yl]methanol |
|---|---|
| PubChem CID | 101334742 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | [(1R,2S,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecan-9-yl]methanol |
| SMILES | CC1(C)O[C@H]2O[C@@H]3[C@@H](OC(C)(C)O[C@H]3CO)[C@@H]2O1 |
| InChI | InChI=1S/C12H20O6/c1-11(2)15-6(5-13)7-8(16-11)9-10(14-7)18-12(3,4)17-9/h6-10,13H,5H2,1-4H3/t6-,7-,8+,9-,10+/m0/s1 |
| InChIKey | FLPLINVCOZNESU-GENCIFFESA-N |
| XLogP | 0.38 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |