C20H40O6Si2 — CID 139060551
(1S,3S,4R,5S,7S,8R)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2,6-dioxatricyclo[3.3.1.13,7]decane-1,3-diol (PubChem CID 139060551) has the molecular formula C20H40O6Si2 and a molecular weight of 432.71 g/mol. Its IUPAC name is (1S,3S,4R,5S,7S,8R)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2,6-dioxatricyclo[3.3.1.13,7]decane-1,3-diol.
| Compound Name | (1S,3S,4R,5S,7S,8R)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2,6-dioxatricyclo[3.3.1.13,7]decane-1,3-diol |
|---|---|
| PubChem CID | 139060551 |
| Molecular Formula | C20H40O6Si2 |
| Molecular Weight | 432.71 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | (1S,3S,4R,5S,7S,8R)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-2,6-dioxatricyclo[3.3.1.13,7]decane-1,3-diol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H]2C[C@]3(O)O[C@@]1(O)C[C@H](O2)[C@H]3O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O6Si2/c1-17(2,3)27(7,8)24-15-13-11-20(22)16(25-28(9,10)18(4,5)6)14(23-13)12-19(15,21)26-20/h13-16,21-22H,11-12H2,1-10H3/t13-,14-,15+,16+,19-,20-/m0/s1 |
| InChIKey | CSQLLGYQYDXYHP-WYDAQNGTSA-N |
| XLogP | 3.74 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.71 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|