C12H23N3O5Si — CID 101437067
(1R,2R,3S,4R,5R)-4-azido-3-[tert-butyl(dimethyl)silyl]oxy-6,8-dioxabicyclo[3.2.1]octane-2,4-diol (PubChem CID 101437067) has the molecular formula C12H23N3O5Si and a molecular weight of 317.42 g/mol. Its IUPAC name is (1R,2R,3S,4R,5R)-4-azido-3-[tert-butyl(dimethyl)silyl]oxy-6,8-dioxabicyclo[3.2.1]octane-2,4-diol.
| Compound Name | (1R,2R,3S,4R,5R)-4-azido-3-[tert-butyl(dimethyl)silyl]oxy-6,8-dioxabicyclo[3.2.1]octane-2,4-diol |
|---|---|
| PubChem CID | 101437067 |
| Molecular Formula | C12H23N3O5Si |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (1R,2R,3S,4R,5R)-4-azido-3-[tert-butyl(dimethyl)silyl]oxy-6,8-dioxabicyclo[3.2.1]octane-2,4-diol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@H]2CO[C@H](O2)[C@@]1(O)N=[N+]=[N-] |
| InChI | InChI=1S/C12H23N3O5Si/c1-11(2,3)21(4,5)20-9-8(16)7-6-18-10(19-7)12(9,17)14-15-13/h7-10,16-17H,6H2,1-5H3/t7-,8-,9+,10-,12-/m1/s1 |
| InChIKey | SCAYDOTZCGFLRL-WSOSLHDDSA-N |
| XLogP | 1.49 |
| TPSA | 116.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|