C13H26O4Si — CID 11254343
(1R,2S,3R,4R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6,8-dioxabicyclo[3.2.1]octan-3-ol (PubChem CID 11254343) has the molecular formula C13H26O4Si and a molecular weight of 274.43 g/mol. Its IUPAC name is (1R,2S,3R,4R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6,8-dioxabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1R,2S,3R,4R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6,8-dioxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 11254343 |
| Molecular Formula | C13H26O4Si |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (1R,2S,3R,4R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6,8-dioxabicyclo[3.2.1]octan-3-ol |
| SMILES | C[C@H]1[C@@H]2OC[C@@H](O2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O |
| InChI | InChI=1S/C13H26O4Si/c1-8-10(14)11(9-7-15-12(8)16-9)17-18(5,6)13(2,3)4/h8-12,14H,7H2,1-6H3/t8-,9-,10-,11-,12-/m1/s1 |
| InChIKey | IBXKDHMXGCTSFK-LZQZFOIKSA-N |
| XLogP | 2.13 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|