C7H13O5P — CID 59042905
(2R,4S,5S)-2-methylphosphanyloxy-6,8-dioxabicyclo[3.2.1]octane-3,4-diol (PubChem CID 59042905) has the molecular formula C7H13O5P and a molecular weight of 208.15 g/mol. Its IUPAC name is (2R,4S,5S)-2-methylphosphanyloxy-6,8-dioxabicyclo[3.2.1]octane-3,4-diol.
| Compound Name | (2R,4S,5S)-2-methylphosphanyloxy-6,8-dioxabicyclo[3.2.1]octane-3,4-diol |
|---|---|
| PubChem CID | 59042905 |
| Molecular Formula | C7H13O5P |
| Molecular Weight | 208.15 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | (2R,4S,5S)-2-methylphosphanyloxy-6,8-dioxabicyclo[3.2.1]octane-3,4-diol |
| SMILES | CPO[C@H]1C2CO[C@@H](O2)[C@@H](O)C1O |
| InChI | InChI=1S/C7H13O5P/c1-13-12-6-3-2-10-7(11-3)5(9)4(6)8/h3-9,13H,2H2,1H3/t3?,4?,5-,6-,7-/m0/s1 |
| InChIKey | RDJKAWFMHPYRBK-HKLOMFLFSA-N |
| XLogP | -0.93 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.15 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|