About 3-amino-6,8-dioxabicyclo[3.2.1]octane-2,4-diol
3-amino-6,8-dioxabicyclo[3.2.1]octane-2,4-diol (PubChem CID 4867520) has the molecular formula C6H11NO4
and a molecular weight of 161.16 g/mol. Its IUPAC name is 3-amino-6,8-dioxabicyclo[3.2.1]octane-2,4-diol.
Molecular Properties
| Compound Name | 3-amino-6,8-dioxabicyclo[3.2.1]octane-2,4-diol |
| PubChem CID | 4867520 |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | 3-amino-6,8-dioxabicyclo[3.2.1]octane-2,4-diol |
| SMILES | NC1C(O)C2COC(O2)C1O |
| InChI | InChI=1S/C6H11NO4/c7-3-4(8)2-1-10-6(11-2)5(3)9/h2-6,8-9H,1,7H2 |
| InChIKey | PWSKXRKZLJHEKE-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-6,8-dioxabicyclo[3.2.1]octane-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-6,8-dioxabicyclo[3.2.1]octane-2,4-diol?
The IUPAC name of 3-amino-6,8-dioxabicyclo[3.2.1]octane-2,4-diol (CID 4867520) is 3-amino-6,8-dioxabicyclo[3.2.1]octane-2,4-diol.
What is the SMILES notation for 3-amino-6,8-dioxabicyclo[3.2.1]octane-2,4-diol?
The canonical SMILES for 3-amino-6,8-dioxabicyclo[3.2.1]octane-2,4-diol is NC1C(O)C2COC(O2)C1O.
What is the InChIKey of 3-amino-6,8-dioxabicyclo[3.2.1]octane-2,4-diol?
The InChIKey is PWSKXRKZLJHEKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO4/c7-3-4(8)2-1-10-6(11-2)5(3)9/h2-6,8-9H,1,7H2.
What are the key properties of 3-amino-6,8-dioxabicyclo[3.2.1]octane-2,4-diol?
3-amino-6,8-dioxabicyclo[3.2.1]octane-2,4-diol has a molecular weight of 161.16 g/mol, XLogP of -2.21, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-6,8-dioxabicyclo[3.2.1]octane-2,4-diol is sourced from PubChem (CID 4867520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).