C9H15NO6 — CID 122222954
(2R)-2-[[(1R,2S,3R,4R,5R)-4-amino-2-hydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]oxy]propanoic acid (PubChem CID 122222954) has the molecular formula C9H15NO6 and a molecular weight of 233.22 g/mol. Its IUPAC name is (2R)-2-[[(1R,2S,3R,4R,5R)-4-amino-2-hydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]oxy]propanoic acid.
| Compound Name | (2R)-2-[[(1R,2S,3R,4R,5R)-4-amino-2-hydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]oxy]propanoic acid |
|---|---|
| PubChem CID | 122222954 |
| Molecular Formula | C9H15NO6 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | (2R)-2-[[(1R,2S,3R,4R,5R)-4-amino-2-hydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]oxy]propanoic acid |
| SMILES | C[C@@H](O[C@@H]1[C@@H](N)[C@@H]2OC[C@@H](O2)[C@H]1O)C(=O)O |
| InChI | InChI=1S/C9H15NO6/c1-3(8(12)13)15-7-5(10)9-14-2-4(16-9)6(7)11/h3-7,9,11H,2,10H2,1H3,(H,12,13)/t3-,4-,5-,6-,7-,9-/m1/s1 |
| InChIKey | CHBVBQWDQGWKGS-KTZFPWNASA-N |
| XLogP | -1.71 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |