C9H16N4O6 — CID 142450264
(2R)-2-[(3R,4R,5S,6R)-3-amino-2-azido-5-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxypropanoic acid (PubChem CID 142450264) has the molecular formula C9H16N4O6 and a molecular weight of 276.25 g/mol. Its IUPAC name is (2R)-2-[(3R,4R,5S,6R)-3-amino-2-azido-5-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxypropanoic acid.
| Compound Name | (2R)-2-[(3R,4R,5S,6R)-3-amino-2-azido-5-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxypropanoic acid |
|---|---|
| PubChem CID | 142450264 |
| Molecular Formula | C9H16N4O6 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | (2R)-2-[(3R,4R,5S,6R)-3-amino-2-azido-5-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxypropanoic acid |
| SMILES | C[C@@H](O[C@H]1[C@H](O)[C@@H](CO)OC(N=[N+]=[N-])[C@@H]1N)C(=O)O |
| InChI | InChI=1S/C9H16N4O6/c1-3(9(16)17)18-7-5(10)8(12-13-11)19-4(2-14)6(7)15/h3-8,14-15H,2,10H2,1H3,(H,16,17)/t3-,4-,5-,6-,7-,8?/m1/s1 |
| InChIKey | GMKYPXRNTSMNLB-CEJORLAHSA-N |
| XLogP | -1.44 |
| TPSA | 171.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|