C9H16N4O4 — CID 131844505
(2R,3S,4R,5R,6R)-6-azido-2-(hydroxymethyl)-5-(propan-2-ylideneamino)oxane-3,4-diol (PubChem CID 131844505) has the molecular formula C9H16N4O4 and a molecular weight of 244.25 g/mol. Its IUPAC name is (2R,3S,4R,5R,6R)-6-azido-2-(hydroxymethyl)-5-(propan-2-ylideneamino)oxane-3,4-diol.
| Compound Name | (2R,3S,4R,5R,6R)-6-azido-2-(hydroxymethyl)-5-(propan-2-ylideneamino)oxane-3,4-diol |
|---|---|
| PubChem CID | 131844505 |
| Molecular Formula | C9H16N4O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | (2R,3S,4R,5R,6R)-6-azido-2-(hydroxymethyl)-5-(propan-2-ylideneamino)oxane-3,4-diol |
| SMILES | CC(C)=N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C9H16N4O4/c1-4(2)11-6-8(16)7(15)5(3-14)17-9(6)12-13-10/h5-9,14-16H,3H2,1-2H3/t5-,6-,7-,8-,9-/m1/s1 |
| InChIKey | QTUQUWMYGJHZEG-JGKVKWKGSA-N |
| XLogP | -0.41 |
| TPSA | 131.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|