C8H14NO6- — CID 22870451
N-[(2S,3R,4R,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]ethanimidate (PubChem CID 22870451) has the molecular formula C8H14NO6- and a molecular weight of 220.20 g/mol. Its IUPAC name is N-[(2S,3R,4R,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]ethanimidate.
| Compound Name | N-[(2S,3R,4R,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]ethanimidate |
|---|---|
| PubChem CID | 22870451 |
| Molecular Formula | C8H14NO6- |
| Molecular Weight | 220.20 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | N-[(2S,3R,4R,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]ethanimidate |
| SMILES | C/C([O-])=N\[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@@H]1O |
| InChI | InChI=1S/C8H15NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-8,10,12-14H,2H2,1H3,(H,9,11)/p-1/t4-,5-,6+,7-,8+/m1/s1 |
| InChIKey | OVRNDRQMDRJTHS-CBQIKETKSA-M |
| XLogP | -3.43 |
| TPSA | 125.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.20 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|