C10H17NO6 — CID 90766738
4-[(3R,4R,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]iminobutan-2-one (PubChem CID 90766738) has the molecular formula C10H17NO6 and a molecular weight of 247.25 g/mol. Its IUPAC name is 4-[(3R,4R,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]iminobutan-2-one.
| Compound Name | 4-[(3R,4R,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]iminobutan-2-one |
|---|---|
| PubChem CID | 90766738 |
| Molecular Formula | C10H17NO6 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 4-[(3R,4R,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]iminobutan-2-one |
| SMILES | CC(=O)C/C=N/[C@H]1C(O)O[C@H](CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H17NO6/c1-5(13)2-3-11-7-9(15)8(14)6(4-12)17-10(7)16/h3,6-10,12,14-16H,2,4H2,1H3/b11-3+/t6-,7-,8+,9-,10?/m1/s1 |
| InChIKey | ZXTGBNORSBKDKJ-WGVIHXEOSA-N |
| XLogP | -2.16 |
| TPSA | 119.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|