C14H28O14 — CID 67893227
acetic acid;6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 67893227) has the molecular formula C14H28O14 and a molecular weight of 420.36 g/mol. Its IUPAC name is acetic acid;6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | acetic acid;6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 67893227 |
| Molecular Formula | C14H28O14 |
| Molecular Weight | 420.36 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | acetic acid;6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | CC(=O)O.CC(=O)O.CC(=O)O.CC(=O)O.OCC1OC(O)C(O)C(O)C1O |
| InChI | InChI=1S/C6H12O6.4C2H4O2/c7-1-2-3(8)4(9)5(10)6(11)12-2;4*1-2(3)4/h2-11H,1H2;4*1H3,(H,3,4) |
| InChIKey | RXTKHLSSCFBBPX-UHFFFAOYSA-N |
| XLogP | -2.86 |
| TPSA | 259.58 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.36 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |