C8H14O10 — CID 11572561
(2R,3R,4R,5R,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;oxalic acid (PubChem CID 11572561) has the molecular formula C8H14O10 and a molecular weight of 270.19 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;oxalic acid.
| Compound Name | (2R,3R,4R,5R,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;oxalic acid |
|---|---|
| PubChem CID | 11572561 |
| Molecular Formula | C8H14O10 |
| Molecular Weight | 270.19 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | (2R,3R,4R,5R,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;oxalic acid |
| SMILES | O=C(O)C(=O)O.OC[C@H]1O[C@@H](O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H12O6.C2H2O4/c7-1-2-3(8)4(9)5(10)6(11)12-2;3-1(4)2(5)6/h2-11H,1H2;(H,3,4)(H,5,6)/t2-,3+,4-,5-,6-;/m1./s1 |
| InChIKey | ROWBRVVDKNCPSQ-AXUKCSBQSA-N |
| XLogP | -4.07 |
| TPSA | 184.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.19 |
| LogP ≤ 5 | -4.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|