C10H16NO8- — CID 100972316
4-hydroxy-4-oxo-N-[(2R,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]butanimidate (PubChem CID 100972316) has the molecular formula C10H16NO8- and a molecular weight of 278.24 g/mol. Its IUPAC name is 4-hydroxy-4-oxo-N-[(2R,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]butanimidate.
| Compound Name | 4-hydroxy-4-oxo-N-[(2R,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]butanimidate |
|---|---|
| PubChem CID | 100972316 |
| Molecular Formula | C10H16NO8- |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 4-hydroxy-4-oxo-N-[(2R,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]butanimidate |
| SMILES | O=C(O)CC/C([O-])=N/[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1O |
| InChI | InChI=1S/C10H17NO8/c12-3-4-8(16)9(17)7(10(18)19-4)11-5(13)1-2-6(14)15/h4,7-10,12,16-18H,1-3H2,(H,11,13)(H,14,15)/p-1/t4-,7-,8-,9-,10-/m1/s1 |
| InChIKey | YCADUTALRCFWBJ-GKKUVZKPSA-M |
| XLogP | -3.59 |
| TPSA | 162.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | -3.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|