C10H19NO9 — CID 158933659
(3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;butanedioic acid (PubChem CID 158933659) has the molecular formula C10H19NO9 and a molecular weight of 297.26 g/mol. Its IUPAC name is (3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;butanedioic acid.
| Compound Name | (3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;butanedioic acid |
|---|---|
| PubChem CID | 158933659 |
| Molecular Formula | C10H19NO9 |
| Molecular Weight | 297.26 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | (3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;butanedioic acid |
| SMILES | N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C6H13NO5.C4H6O4/c7-3-5(10)4(9)2(1-8)12-6(3)11;5-3(6)1-2-4(7)8/h2-6,8-11H,1,7H2;1-2H2,(H,5,6)(H,7,8)/t2-,3-,4-,5-,6?;/m1./s1 |
| InChIKey | JJJNKEAGEROCGS-NSEZLWDYSA-N |
| XLogP | -3.32 |
| TPSA | 190.77 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.26 |
| LogP ≤ 5 | -3.32 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |