C10H21NO7 — CID 134501433
(3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;butanoic acid (PubChem CID 134501433) has the molecular formula C10H21NO7 and a molecular weight of 267.28 g/mol. Its IUPAC name is (3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;butanoic acid.
| Compound Name | (3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;butanoic acid |
|---|---|
| PubChem CID | 134501433 |
| Molecular Formula | C10H21NO7 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;butanoic acid |
| SMILES | CCCC(=O)O.N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13NO5.C4H8O2/c7-3-5(10)4(9)2(1-8)12-6(3)11;1-2-3-4(5)6/h2-6,8-11H,1,7H2;2-3H2,1H3,(H,5,6)/t2-,3-,4-,5-,6?;/m1./s1 |
| InChIKey | KUQFQRFOOQDMFS-NSEZLWDYSA-N |
| XLogP | -2.38 |
| TPSA | 153.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |