C8H14NNaO9S — CID 101133305
sodium N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(sulfooxymethyl)oxan-3-yl]ethanimidate (PubChem CID 101133305) has the molecular formula C8H14NNaO9S and a molecular weight of 323.26 g/mol. Its IUPAC name is sodium N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(sulfooxymethyl)oxan-3-yl]ethanimidate.
| Compound Name | sodium N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(sulfooxymethyl)oxan-3-yl]ethanimidate |
|---|---|
| PubChem CID | 101133305 |
| Molecular Formula | C8H14NNaO9S |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | sodium N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(sulfooxymethyl)oxan-3-yl]ethanimidate |
| SMILES | C/C([O-])=N\[C@H]1C(O)O[C@H](COS(=O)(=O)O)[C@@H](O)[C@@H]1O.[Na+] |
| InChI | InChI=1S/C8H15NO9S.Na/c1-3(10)9-5-7(12)6(11)4(18-8(5)13)2-17-19(14,15)16;/h4-8,11-13H,2H2,1H3,(H,9,10)(H,14,15,16);/q;+1/p-1/t4-,5-,6-,7-,8?;/m1./s1 |
| InChIKey | CBUJZKTVEFVBBG-FROKLYQUSA-M |
| XLogP | -6.60 |
| TPSA | 168.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | -6.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|