C16H29N4NaO10S2 — CID 132565443
sodium N-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamothioylamino]-6-(sulfooxymethyl)oxan-3-yl]ethanimidate (PubChem CID 132565443) has the molecular formula C16H29N4NaO10S2 and a molecular weight of 524.55 g/mol. Its IUPAC name is sodium N-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamothioylamino]-6-(sulfooxymethyl)oxan-3-yl]ethanimidate.
| Compound Name | sodium N-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamothioylamino]-6-(sulfooxymethyl)oxan-3-yl]ethanimidate |
|---|---|
| PubChem CID | 132565443 |
| Molecular Formula | C16H29N4NaO10S2 |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | sodium N-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamothioylamino]-6-(sulfooxymethyl)oxan-3-yl]ethanimidate |
| SMILES | C/C([O-])=N\[C@@H]1[C@@H](O)[C@H](O)[C@@H](COS(=O)(=O)O)O[C@H]1NC(=S)NCCNC(=O)OC(C)(C)C.[Na+] |
| InChI | InChI=1S/C16H30N4O10S2.Na/c1-8(21)19-10-12(23)11(22)9(7-28-32(25,26)27)29-13(10)20-14(31)17-5-6-18-15(24)30-16(2,3)4;/h9-13,22-23H,5-7H2,1-4H3,(H,18,24)(H,19,21)(H2,17,20,31)(H,25,26,27);/q;+1/p-1/t9-,10-,11-,12-,13-;/m1./s1 |
| InChIKey | HWFQPPRUOSSICL-GATVXMMLSA-M |
| XLogP | -5.61 |
| TPSA | 211.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | -5.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|