C8H12F3NO9S — CID 90352174
[(3S,4R)-3,4,6-trihydroxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl hydrogen sulfate (PubChem CID 90352174) has the molecular formula C8H12F3NO9S and a molecular weight of 355.24 g/mol. Its IUPAC name is [(3S,4R)-3,4,6-trihydroxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl hydrogen sulfate.
| Compound Name | [(3S,4R)-3,4,6-trihydroxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 90352174 |
| Molecular Formula | C8H12F3NO9S |
| Molecular Weight | 355.24 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | [(3S,4R)-3,4,6-trihydroxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl hydrogen sulfate |
| SMILES | O=C(NC1C(O)OC(COS(=O)(=O)O)[C@@H](O)[C@@H]1O)C(F)(F)F |
| InChI | InChI=1S/C8H12F3NO9S/c9-8(10,11)7(16)12-3-5(14)4(13)2(21-6(3)15)1-20-22(17,18)19/h2-6,13-15H,1H2,(H,12,16)(H,17,18,19)/t2?,3?,4-,5-,6?/m1/s1 |
| InChIKey | PKHHLSIDESMIKP-BKAHITNQSA-N |
| XLogP | -2.71 |
| TPSA | 162.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.24 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|