C8H11F3NO8- — CID 140650415
2,2,2-trifluoro-N-[(2R,4R,5S)-2,4,5-trihydroxy-6-(oxidoperoxymethyl)oxan-3-yl]acetamide (PubChem CID 140650415) has the molecular formula C8H11F3NO8- and a molecular weight of 306.17 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(2R,4R,5S)-2,4,5-trihydroxy-6-(oxidoperoxymethyl)oxan-3-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(2R,4R,5S)-2,4,5-trihydroxy-6-(oxidoperoxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 140650415 |
| Molecular Formula | C8H11F3NO8- |
| Molecular Weight | 306.17 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 2,2,2-trifluoro-N-[(2R,4R,5S)-2,4,5-trihydroxy-6-(oxidoperoxymethyl)oxan-3-yl]acetamide |
| SMILES | O=C(NC1[C@H](O)OC(COO[O-])[C@@H](O)[C@@H]1O)C(F)(F)F |
| InChI | InChI=1S/C8H12F3NO8/c9-8(10,11)7(16)12-3-5(14)4(13)2(1-18-20-17)19-6(3)15/h2-6,13-15,17H,1H2,(H,12,16)/p-1/t2?,3?,4-,5-,6-/m1/s1 |
| InChIKey | PXXXCGWDYKXRRY-YHMDAOSXSA-M |
| XLogP | -3.30 |
| TPSA | 140.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.17 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|