C14H25NO7 — CID 139295403
[(2R,3S,4R,5R)-5-(butanoylamino)-3,4,6-trihydroxyoxan-2-yl]methyl butanoate (PubChem CID 139295403) has the molecular formula C14H25NO7 and a molecular weight of 319.35 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(butanoylamino)-3,4,6-trihydroxyoxan-2-yl]methyl butanoate.
| Compound Name | [(2R,3S,4R,5R)-5-(butanoylamino)-3,4,6-trihydroxyoxan-2-yl]methyl butanoate |
|---|---|
| PubChem CID | 139295403 |
| Molecular Formula | C14H25NO7 |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(butanoylamino)-3,4,6-trihydroxyoxan-2-yl]methyl butanoate |
| SMILES | CCCC(=O)N[C@H]1C(O)O[C@H](COC(=O)CCC)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H25NO7/c1-3-5-9(16)15-11-13(19)12(18)8(22-14(11)20)7-21-10(17)6-4-2/h8,11-14,18-20H,3-7H2,1-2H3,(H,15,16)/t8-,11-,12-,13-,14?/m1/s1 |
| InChIKey | SCZUVKPDFRKRNK-RGCGOGFISA-N |
| XLogP | -0.95 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |