C13H25NO7 — CID 139295558
N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(2-methoxyethoxymethyl)oxan-3-yl]butanamide (PubChem CID 139295558) has the molecular formula C13H25NO7 and a molecular weight of 307.34 g/mol. Its IUPAC name is N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(2-methoxyethoxymethyl)oxan-3-yl]butanamide.
| Compound Name | N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(2-methoxyethoxymethyl)oxan-3-yl]butanamide |
|---|---|
| PubChem CID | 139295558 |
| Molecular Formula | C13H25NO7 |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(2-methoxyethoxymethyl)oxan-3-yl]butanamide |
| SMILES | CCCC(=O)N[C@H]1C(O)O[C@H](COCCOC)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H25NO7/c1-3-4-9(15)14-10-12(17)11(16)8(21-13(10)18)7-20-6-5-19-2/h8,10-13,16-18H,3-7H2,1-2H3,(H,14,15)/t8-,10-,11-,12-,13?/m1/s1 |
| InChIKey | IWKXKDNIALXUKX-FLBHPLMVSA-N |
| XLogP | -1.63 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|