C14H23NO9 — CID 139295352
4-[[(2R,3S,4R,5R)-5-(butanoylamino)-3,4,6-trihydroxyoxan-2-yl]methoxy]-4-oxobutanoic acid (PubChem CID 139295352) has the molecular formula C14H23NO9 and a molecular weight of 349.34 g/mol. Its IUPAC name is 4-[[(2R,3S,4R,5R)-5-(butanoylamino)-3,4,6-trihydroxyoxan-2-yl]methoxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(2R,3S,4R,5R)-5-(butanoylamino)-3,4,6-trihydroxyoxan-2-yl]methoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 139295352 |
| Molecular Formula | C14H23NO9 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 4-[[(2R,3S,4R,5R)-5-(butanoylamino)-3,4,6-trihydroxyoxan-2-yl]methoxy]-4-oxobutanoic acid |
| SMILES | CCCC(=O)N[C@H]1C(O)O[C@H](COC(=O)CCC(=O)O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H23NO9/c1-2-3-8(16)15-11-13(21)12(20)7(24-14(11)22)6-23-10(19)5-4-9(17)18/h7,11-14,20-22H,2-6H2,1H3,(H,15,16)(H,17,18)/t7-,11-,12-,13-,14?/m1/s1 |
| InChIKey | GFQOXBCZXJBSAE-LZXMZVSGSA-N |
| XLogP | -1.88 |
| TPSA | 162.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |