C19H34N2O9 — CID 139295368
[(2R,3S,5R)-5-(butanoylamino)-3,4,6-trihydroxyoxan-2-yl]methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 139295368) has the molecular formula C19H34N2O9 and a molecular weight of 434.49 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(butanoylamino)-3,4,6-trihydroxyoxan-2-yl]methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | [(2R,3S,5R)-5-(butanoylamino)-3,4,6-trihydroxyoxan-2-yl]methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 139295368 |
| Molecular Formula | C19H34N2O9 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | [(2R,3S,5R)-5-(butanoylamino)-3,4,6-trihydroxyoxan-2-yl]methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CCCC(=O)N[C@H]1C(O)O[C@H](COC(=O)CCCNC(=O)OC(C)(C)C)[C@@H](O)C1O |
| InChI | InChI=1S/C19H34N2O9/c1-5-7-12(22)21-14-16(25)15(24)11(29-17(14)26)10-28-13(23)8-6-9-20-18(27)30-19(2,3)4/h11,14-17,24-26H,5-10H2,1-4H3,(H,20,27)(H,21,22)/t11-,14-,15-,16?,17?/m1/s1 |
| InChIKey | QEQFDACCNCOLDL-JXGMDYFLSA-N |
| XLogP | -0.44 |
| TPSA | 163.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|