C15H30ClN2O7+ — CID 159491582
[2-[[(2R,3S,4R,5R)-5-(butanoylamino)-3,4,6-trihydroxyoxan-2-yl]methoxy]-2-oxoethyl]-trimethylazanium;hydrochloride (PubChem CID 159491582) has the molecular formula C15H30ClN2O7+ and a molecular weight of 385.87 g/mol. Its IUPAC name is [2-[[(2R,3S,4R,5R)-5-(butanoylamino)-3,4,6-trihydroxyoxan-2-yl]methoxy]-2-oxoethyl]-trimethylazanium;hydrochloride.
| Compound Name | [2-[[(2R,3S,4R,5R)-5-(butanoylamino)-3,4,6-trihydroxyoxan-2-yl]methoxy]-2-oxoethyl]-trimethylazanium;hydrochloride |
|---|---|
| PubChem CID | 159491582 |
| Molecular Formula | C15H30ClN2O7+ |
| Molecular Weight | 385.87 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | [2-[[(2R,3S,4R,5R)-5-(butanoylamino)-3,4,6-trihydroxyoxan-2-yl]methoxy]-2-oxoethyl]-trimethylazanium;hydrochloride |
| SMILES | CCCC(=O)N[C@H]1C(O)O[C@H](COC(=O)C[N+](C)(C)C)[C@@H](O)[C@@H]1O.Cl |
| InChI | InChI=1S/C15H28N2O7.ClH/c1-5-6-10(18)16-12-14(21)13(20)9(24-15(12)22)8-23-11(19)7-17(2,3)4;/h9,12-15,20-22H,5-8H2,1-4H3;1H/p+1/t9-,12-,13-,14-,15?;/m1./s1 |
| InChIKey | CXKGVZQMFRVGTP-ABQMZMCKSA-O |
| XLogP | -1.62 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.87 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|