C16H29NO7 — CID 69271413
[(2R,3S,4R,5S,6S)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methyl octanoate (PubChem CID 69271413) has the molecular formula C16H29NO7 and a molecular weight of 347.41 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6S)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methyl octanoate.
| Compound Name | [(2R,3S,4R,5S,6S)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methyl octanoate |
|---|---|
| PubChem CID | 69271413 |
| Molecular Formula | C16H29NO7 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | [(2R,3S,4R,5S,6S)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methyl octanoate |
| SMILES | CCCCCCCC(=O)OC[C@H]1O[C@H](O)[C@@H](NC(C)=O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H29NO7/c1-3-4-5-6-7-8-12(19)23-9-11-14(20)15(21)13(16(22)24-11)17-10(2)18/h11,13-16,20-22H,3-9H2,1-2H3,(H,17,18)/t11-,13+,14-,15-,16+/m1/s1 |
| InChIKey | NBIOTOPSRGCMBM-ZIRHEVKLSA-N |
| XLogP | -0.17 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|