C10H17NO7 — CID 135070648
[(3S,6R)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methyl acetate (PubChem CID 135070648) has the molecular formula C10H17NO7 and a molecular weight of 263.25 g/mol. Its IUPAC name is [(3S,6R)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(3S,6R)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 135070648 |
| Molecular Formula | C10H17NO7 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | [(3S,6R)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)NC1C(O)[C@H](O)C(COC(C)=O)O[C@H]1O |
| InChI | InChI=1S/C10H17NO7/c1-4(12)11-7-9(15)8(14)6(18-10(7)16)3-17-5(2)13/h6-10,14-16H,3H2,1-2H3,(H,11,12)/t6?,7?,8-,9?,10-/m1/s1 |
| InChIKey | BUOUIFKLABWPRZ-DRAUJQIPSA-N |
| XLogP | -2.51 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |