C27H45N3O9 — CID 139295340
[(2R,3S,4R,5R)-5-(butanoylamino)-3-(cyclohexylcarbamoyloxy)-4,6-dihydroxyoxan-2-yl]methyl 4-(cyclohexylamino)-4-oxobutanoate (PubChem CID 139295340) has the molecular formula C27H45N3O9 and a molecular weight of 555.67 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(butanoylamino)-3-(cyclohexylcarbamoyloxy)-4,6-dihydroxyoxan-2-yl]methyl 4-(cyclohexylamino)-4-oxobutanoate.
| Compound Name | [(2R,3S,4R,5R)-5-(butanoylamino)-3-(cyclohexylcarbamoyloxy)-4,6-dihydroxyoxan-2-yl]methyl 4-(cyclohexylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 139295340 |
| Molecular Formula | C27H45N3O9 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.32 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(butanoylamino)-3-(cyclohexylcarbamoyloxy)-4,6-dihydroxyoxan-2-yl]methyl 4-(cyclohexylamino)-4-oxobutanoate |
| SMILES | CCCC(=O)N[C@H]1C(O)O[C@H](COC(=O)CCC(=O)NC2CCCCC2)[C@@H](OC(=O)NC2CCCCC2)[C@@H]1O |
| InChI | InChI=1S/C27H45N3O9/c1-2-9-20(31)30-23-24(34)25(39-27(36)29-18-12-7-4-8-13-18)19(38-26(23)35)16-37-22(33)15-14-21(32)28-17-10-5-3-6-11-17/h17-19,23-26,34-35H,2-16H2,1H3,(H,28,32)(H,29,36)(H,30,31)/t19-,23-,24-,25-,26?/m1/s1 |
| InChIKey | YCUSKCSDVGEZNK-RXCYFZDISA-N |
| XLogP | 1.55 |
| TPSA | 172.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |