C20H33NO9 — CID 67368162
[(2R,3S,4R,5R,6S)-5-acetamido-3,4-di(butanoyloxy)-6-hydroxyoxan-2-yl]methyl butanoate (PubChem CID 67368162) has the molecular formula C20H33NO9 and a molecular weight of 431.48 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-acetamido-3,4-di(butanoyloxy)-6-hydroxyoxan-2-yl]methyl butanoate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-acetamido-3,4-di(butanoyloxy)-6-hydroxyoxan-2-yl]methyl butanoate |
|---|---|
| PubChem CID | 67368162 |
| Molecular Formula | C20H33NO9 |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-acetamido-3,4-di(butanoyloxy)-6-hydroxyoxan-2-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[C@H]1O[C@H](O)[C@H](NC(C)=O)[C@@H](OC(=O)CCC)[C@@H]1OC(=O)CCC |
| InChI | InChI=1S/C20H33NO9/c1-5-8-14(23)27-11-13-18(29-15(24)9-6-2)19(30-16(25)10-7-3)17(20(26)28-13)21-12(4)22/h13,17-20,26H,5-11H2,1-4H3,(H,21,22)/t13-,17-,18-,19-,20+/m1/s1 |
| InChIKey | DTPHGSQWPXFANX-OJRASUONSA-N |
| XLogP | 0.98 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|