C14H24O7 — CID 86272045
[(2R,3S,4R,6S)-3-butanoyloxy-4,6-dihydroxyoxan-2-yl]methyl butanoate (PubChem CID 86272045) has the molecular formula C14H24O7 and a molecular weight of 304.34 g/mol. Its IUPAC name is [(2R,3S,4R,6S)-3-butanoyloxy-4,6-dihydroxyoxan-2-yl]methyl butanoate.
| Compound Name | [(2R,3S,4R,6S)-3-butanoyloxy-4,6-dihydroxyoxan-2-yl]methyl butanoate |
|---|---|
| PubChem CID | 86272045 |
| Molecular Formula | C14H24O7 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | [(2R,3S,4R,6S)-3-butanoyloxy-4,6-dihydroxyoxan-2-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[C@H]1O[C@H](O)C[C@@H](O)[C@@H]1OC(=O)CCC |
| InChI | InChI=1S/C14H24O7/c1-3-5-11(16)19-8-10-14(21-12(17)6-4-2)9(15)7-13(18)20-10/h9-10,13-15,18H,3-8H2,1-2H3/t9-,10-,13+,14+/m1/s1 |
| InChIKey | YTDQMADLFZEMMD-JYILRKAJSA-N |
| XLogP | 0.51 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |