C26H38O13 — CID 146628735
(E)-4-oxo-4-[(2R,3R,4S,5R,6R)-3,4,5-tri(butanoyloxy)-6-(butanoyloxymethyl)oxan-2-yl]oxybut-2-enoic acid (PubChem CID 146628735) has the molecular formula C26H38O13 and a molecular weight of 558.58 g/mol. Its IUPAC name is (E)-4-oxo-4-[(2R,3R,4S,5R,6R)-3,4,5-tri(butanoyloxy)-6-(butanoyloxymethyl)oxan-2-yl]oxybut-2-enoic acid.
| Compound Name | (E)-4-oxo-4-[(2R,3R,4S,5R,6R)-3,4,5-tri(butanoyloxy)-6-(butanoyloxymethyl)oxan-2-yl]oxybut-2-enoic acid |
|---|---|
| PubChem CID | 146628735 |
| Molecular Formula | C26H38O13 |
| Molecular Weight | 558.58 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | (E)-4-oxo-4-[(2R,3R,4S,5R,6R)-3,4,5-tri(butanoyloxy)-6-(butanoyloxymethyl)oxan-2-yl]oxybut-2-enoic acid |
| SMILES | CCCC(=O)OC[C@H]1O[C@H](OC(=O)/C=C/C(=O)O)[C@H](OC(=O)CCC)[C@@H](OC(=O)CCC)[C@@H]1OC(=O)CCC |
| InChI | InChI=1S/C26H38O13/c1-5-9-18(29)34-15-16-23(36-19(30)10-6-2)24(37-20(31)11-7-3)25(38-21(32)12-8-4)26(35-16)39-22(33)14-13-17(27)28/h13-14,16,23-26H,5-12,15H2,1-4H3,(H,27,28)/b14-13+/t16-,23-,24+,25-,26-/m1/s1 |
| InChIKey | XTZJNDSUUWHBCI-GRGUYZBESA-N |
| XLogP | 2.37 |
| TPSA | 178.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.58 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|