C27H40O13 — CID 146628887
1-O-methyl 4-O-[[(2R,3S,4S,5R,6R)-3,4,5,6-tetra(butanoyloxy)oxan-2-yl]methyl] (E)-but-2-enedioate (PubChem CID 146628887) has the molecular formula C27H40O13 and a molecular weight of 572.60 g/mol. Its IUPAC name is 1-O-methyl 4-O-[[(2R,3S,4S,5R,6R)-3,4,5,6-tetra(butanoyloxy)oxan-2-yl]methyl] (E)-but-2-enedioate.
| Compound Name | 1-O-methyl 4-O-[[(2R,3S,4S,5R,6R)-3,4,5,6-tetra(butanoyloxy)oxan-2-yl]methyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 146628887 |
| Molecular Formula | C27H40O13 |
| Molecular Weight | 572.60 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | 1-O-methyl 4-O-[[(2R,3S,4S,5R,6R)-3,4,5,6-tetra(butanoyloxy)oxan-2-yl]methyl] (E)-but-2-enedioate |
| SMILES | CCCC(=O)O[C@H]1O[C@H](COC(=O)/C=C/C(=O)OC)[C@H](OC(=O)CCC)[C@H](OC(=O)CCC)[C@H]1OC(=O)CCC |
| InChI | InChI=1S/C27H40O13/c1-6-10-20(30)37-24-17(16-35-19(29)15-14-18(28)34-5)36-27(40-23(33)13-9-4)26(39-22(32)12-8-3)25(24)38-21(31)11-7-2/h14-15,17,24-27H,6-13,16H2,1-5H3/b15-14+/t17-,24+,25+,26-,27-/m1/s1 |
| InChIKey | DOFGOUXDDDTPJW-NQSFYQQLSA-N |
| XLogP | 2.46 |
| TPSA | 167.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.60 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|