C19H28O11 — CID 102382284
[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] pentanoate (PubChem CID 102382284) has the molecular formula C19H28O11 and a molecular weight of 432.42 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] pentanoate.
| Compound Name | [(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] pentanoate |
|---|---|
| PubChem CID | 102382284 |
| Molecular Formula | C19H28O11 |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] pentanoate |
| SMILES | CCCCC(=O)O[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H28O11/c1-6-7-8-15(24)30-19-18(28-13(5)23)17(27-12(4)22)16(26-11(3)21)14(29-19)9-25-10(2)20/h14,16-19H,6-9H2,1-5H3/t14-,16-,17+,18-,19+/m1/s1 |
| InChIKey | RBSSUHLPBRMXAZ-FTWQHDNSSA-N |
| XLogP | 0.80 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|