C24H40O13 — CID 22890126
[3-acetyloxy-2-(acetyloxymethyl)-5-butanoyloxy-6-(2,3,4-trihydroxybutoxy)oxan-4-yl] hexanoate (PubChem CID 22890126) has the molecular formula C24H40O13 and a molecular weight of 536.57 g/mol. Its IUPAC name is [3-acetyloxy-2-(acetyloxymethyl)-5-butanoyloxy-6-(2,3,4-trihydroxybutoxy)oxan-4-yl] hexanoate.
| Compound Name | [3-acetyloxy-2-(acetyloxymethyl)-5-butanoyloxy-6-(2,3,4-trihydroxybutoxy)oxan-4-yl] hexanoate |
|---|---|
| PubChem CID | 22890126 |
| Molecular Formula | C24H40O13 |
| Molecular Weight | 536.57 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | [3-acetyloxy-2-(acetyloxymethyl)-5-butanoyloxy-6-(2,3,4-trihydroxybutoxy)oxan-4-yl] hexanoate |
| SMILES | CCCCCC(=O)OC1C(OC(C)=O)C(COC(C)=O)OC(OCC(O)C(O)CO)C1OC(=O)CCC |
| InChI | InChI=1S/C24H40O13/c1-5-7-8-10-20(31)36-22-21(34-15(4)27)18(13-32-14(3)26)35-24(23(22)37-19(30)9-6-2)33-12-17(29)16(28)11-25/h16-18,21-25,28-29H,5-13H2,1-4H3 |
| InChIKey | DUXGEMYKZPUJNL-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 184.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.57 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|