C32H58O12 — CID 177439340
[(2R,3R,4S,5S,6R)-3-acetyloxy-5-decanoyloxy-2-(hydroxymethyl)-6-[(2R,3R)-2,3,4-trihydroxybutoxy]oxan-4-yl] decanoate (PubChem CID 177439340) has the molecular formula C32H58O12 and a molecular weight of 634.80 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-3-acetyloxy-5-decanoyloxy-2-(hydroxymethyl)-6-[(2R,3R)-2,3,4-trihydroxybutoxy]oxan-4-yl] decanoate.
| Compound Name | [(2R,3R,4S,5S,6R)-3-acetyloxy-5-decanoyloxy-2-(hydroxymethyl)-6-[(2R,3R)-2,3,4-trihydroxybutoxy]oxan-4-yl] decanoate |
|---|---|
| PubChem CID | 177439340 |
| Molecular Formula | C32H58O12 |
| Molecular Weight | 634.80 g/mol |
| Exact Mass | 634.39 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-3-acetyloxy-5-decanoyloxy-2-(hydroxymethyl)-6-[(2R,3R)-2,3,4-trihydroxybutoxy]oxan-4-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)O[C@@H]1[C@H](OC(=O)CCCCCCCCC)[C@H](OC[C@@H](O)[C@H](O)CO)O[C@H](CO)[C@H]1OC(C)=O |
| InChI | InChI=1S/C32H58O12/c1-4-6-8-10-12-14-16-18-27(38)43-30-29(41-23(3)35)26(21-34)42-32(40-22-25(37)24(36)20-33)31(30)44-28(39)19-17-15-13-11-9-7-5-2/h24-26,29-34,36-37H,4-22H2,1-3H3/t24-,25-,26-,29-,30+,31+,32-/m1/s1 |
| InChIKey | CHXIBJGCZXXQGS-HFZDPGPNSA-N |
| XLogP | 3.47 |
| TPSA | 178.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.80 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|