C26H48O11 — CID 101497196
[(2R,3R,4S,5S,6R)-3-hydroxy-2-(hydroxymethyl)-5-octanoyloxy-6-(2,3,4-trihydroxybutoxy)oxan-4-yl] octanoate (PubChem CID 101497196) has the molecular formula C26H48O11 and a molecular weight of 536.66 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-3-hydroxy-2-(hydroxymethyl)-5-octanoyloxy-6-(2,3,4-trihydroxybutoxy)oxan-4-yl] octanoate.
| Compound Name | [(2R,3R,4S,5S,6R)-3-hydroxy-2-(hydroxymethyl)-5-octanoyloxy-6-(2,3,4-trihydroxybutoxy)oxan-4-yl] octanoate |
|---|---|
| PubChem CID | 101497196 |
| Molecular Formula | C26H48O11 |
| Molecular Weight | 536.66 g/mol |
| Exact Mass | 536.32 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-3-hydroxy-2-(hydroxymethyl)-5-octanoyloxy-6-(2,3,4-trihydroxybutoxy)oxan-4-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@@H]1[C@H](OCC(O)C(O)CO)O[C@H](CO)[C@@H](O)[C@@H]1OC(=O)CCCCCCC |
| InChI | InChI=1S/C26H48O11/c1-3-5-7-9-11-13-21(31)36-24-23(33)20(16-28)35-26(34-17-19(30)18(29)15-27)25(24)37-22(32)14-12-10-8-6-4-2/h18-20,23-30,33H,3-17H2,1-2H3/t18?,19?,20-,23-,24+,25+,26-/m1/s1 |
| InChIKey | UWXUONZCFBMISF-FSWDDADJSA-N |
| XLogP | 1.34 |
| TPSA | 172.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.66 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|