C18H34O11 — CID 150669863
[(2S,3S,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[(2S,3R)-1,2,3,4-tetrahydroxybutoxy]oxan-3-yl] octanoate (PubChem CID 150669863) has the molecular formula C18H34O11 and a molecular weight of 426.46 g/mol. Its IUPAC name is [(2S,3S,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[(2S,3R)-1,2,3,4-tetrahydroxybutoxy]oxan-3-yl] octanoate.
| Compound Name | [(2S,3S,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[(2S,3R)-1,2,3,4-tetrahydroxybutoxy]oxan-3-yl] octanoate |
|---|---|
| PubChem CID | 150669863 |
| Molecular Formula | C18H34O11 |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | [(2S,3S,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[(2S,3R)-1,2,3,4-tetrahydroxybutoxy]oxan-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@@H]1[C@H](OC(O)[C@@H](O)[C@H](O)CO)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H34O11/c1-2-3-4-5-6-7-12(22)28-16-15(25)14(24)11(9-20)27-18(16)29-17(26)13(23)10(21)8-19/h10-11,13-21,23-26H,2-9H2,1H3/t10-,11-,13+,14-,15+,16+,17?,18+/m1/s1 |
| InChIKey | JFQQNZUKVGQMRL-ULICKQRGSA-N |
| XLogP | -2.25 |
| TPSA | 186.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|