C44H80O16 — CID 90109088
[(2R,3R,4S,5S,6R)-6-[(2S,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]-3,4,5-tri(octanoyloxy)oxan-2-yl]methyl octanoate (PubChem CID 90109088) has the molecular formula C44H80O16 and a molecular weight of 865.11 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-6-[(2S,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]-3,4,5-tri(octanoyloxy)oxan-2-yl]methyl octanoate.
| Compound Name | [(2R,3R,4S,5S,6R)-6-[(2S,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]-3,4,5-tri(octanoyloxy)oxan-2-yl]methyl octanoate |
|---|---|
| PubChem CID | 90109088 |
| Molecular Formula | C44H80O16 |
| Molecular Weight | 865.11 g/mol |
| Exact Mass | 864.54 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-6-[(2S,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]-3,4,5-tri(octanoyloxy)oxan-2-yl]methyl octanoate |
| SMILES | CCCCCCCC(=O)OC[C@H]1O[C@H](OC(O)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)[C@@H](OC(=O)CCCCCCC)[C@@H](OC(=O)CCCCCCC)[C@@H]1OC(=O)CCCCCCC |
| InChI | InChI=1S/C44H80O16/c1-5-9-13-17-21-25-33(47)55-30-32-40(57-34(48)26-22-18-14-10-6-2)41(58-35(49)27-23-19-15-11-7-3)42(59-36(50)28-24-20-16-12-8-4)44(56-32)60-43(54)39(53)38(52)37(51)31(46)29-45/h31-32,37-46,51-54H,5-30H2,1-4H3/t31-,32-,37-,38+,39+,40-,41+,42+,43?,44-/m1/s1 |
| InChIKey | DFUFIWTXLRQKBV-XGTRMQIUSA-N |
| XLogP | 5.20 |
| TPSA | 245.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 60 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.11 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|