C41H72O16 — CID 151069994
[(2S,3S,4S,5R,6R)-2-[(2S,3S,4S,5S)-1,2,3,4,5,6-hexahydroxy-7-methyloct-6-enoxy]-4,5-di(hexanoyloxy)-6-(hexanoyloxymethyl)oxan-3-yl] octanoate (PubChem CID 151069994) has the molecular formula C41H72O16 and a molecular weight of 821.01 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6R)-2-[(2S,3S,4S,5S)-1,2,3,4,5,6-hexahydroxy-7-methyloct-6-enoxy]-4,5-di(hexanoyloxy)-6-(hexanoyloxymethyl)oxan-3-yl] octanoate.
| Compound Name | [(2S,3S,4S,5R,6R)-2-[(2S,3S,4S,5S)-1,2,3,4,5,6-hexahydroxy-7-methyloct-6-enoxy]-4,5-di(hexanoyloxy)-6-(hexanoyloxymethyl)oxan-3-yl] octanoate |
|---|---|
| PubChem CID | 151069994 |
| Molecular Formula | C41H72O16 |
| Molecular Weight | 821.01 g/mol |
| Exact Mass | 820.48 |
| IUPAC Name | [(2S,3S,4S,5R,6R)-2-[(2S,3S,4S,5S)-1,2,3,4,5,6-hexahydroxy-7-methyloct-6-enoxy]-4,5-di(hexanoyloxy)-6-(hexanoyloxymethyl)oxan-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@@H]1[C@H](OC(O)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)=C(C)C)O[C@H](COC(=O)CCCCC)[C@@H](OC(=O)CCCCC)[C@@H]1OC(=O)CCCCC |
| InChI | InChI=1S/C41H72O16/c1-7-11-15-16-20-24-31(45)56-39-38(55-30(44)23-19-14-10-4)37(54-29(43)22-18-13-9-3)27(25-52-28(42)21-17-12-8-2)53-41(39)57-40(51)36(50)35(49)34(48)33(47)32(46)26(5)6/h27,33-41,46-51H,7-25H2,1-6H3/t27-,33-,34-,35+,36+,37-,38+,39+,40?,41+/m1/s1 |
| InChIKey | MHXXJLQDKSAKTC-KRQOWCKTSA-N |
| XLogP | 4.72 |
| TPSA | 245.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.01 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|