C38H68O16 — CID 86717251
[(2S,3S,4S,5R,6R)-2-[(2S,3R,4R,5S)-1,2,3,4,5,6-hexahydroxyhexoxy]-4,5-di(hexanoyloxy)-6-(hexanoyloxymethyl)oxan-3-yl] octanoate (PubChem CID 86717251) has the molecular formula C38H68O16 and a molecular weight of 780.95 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6R)-2-[(2S,3R,4R,5S)-1,2,3,4,5,6-hexahydroxyhexoxy]-4,5-di(hexanoyloxy)-6-(hexanoyloxymethyl)oxan-3-yl] octanoate.
| Compound Name | [(2S,3S,4S,5R,6R)-2-[(2S,3R,4R,5S)-1,2,3,4,5,6-hexahydroxyhexoxy]-4,5-di(hexanoyloxy)-6-(hexanoyloxymethyl)oxan-3-yl] octanoate |
|---|---|
| PubChem CID | 86717251 |
| Molecular Formula | C38H68O16 |
| Molecular Weight | 780.95 g/mol |
| Exact Mass | 780.45 |
| IUPAC Name | [(2S,3S,4S,5R,6R)-2-[(2S,3R,4R,5S)-1,2,3,4,5,6-hexahydroxyhexoxy]-4,5-di(hexanoyloxy)-6-(hexanoyloxymethyl)oxan-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@@H]1[C@H](OC(O)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)CO)O[C@H](COC(=O)CCCCC)[C@@H](OC(=O)CCCCC)[C@@H]1OC(=O)CCCCC |
| InChI | InChI=1S/C38H68O16/c1-5-9-13-14-18-22-30(44)53-36-35(52-29(43)21-17-12-8-4)34(51-28(42)20-16-11-7-3)26(24-49-27(41)19-15-10-6-2)50-38(36)54-37(48)33(47)32(46)31(45)25(40)23-39/h25-26,31-40,45-48H,5-24H2,1-4H3/t25-,26+,31+,32+,33-,34+,35-,36-,37?,38-/m0/s1 |
| InChIKey | OKYJBFKOYFNQEC-ZLOISGHGSA-N |
| XLogP | 2.86 |
| TPSA | 245.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.95 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|