C28H48O16 — CID 90111027
[(2R,3R,4S,5S,6S)-3,4,5-tri(butanoyloxy)-6-[(2S,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]oxan-2-yl]methyl butanoate (PubChem CID 90111027) has the molecular formula C28H48O16 and a molecular weight of 640.68 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-3,4,5-tri(butanoyloxy)-6-[(2S,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]oxan-2-yl]methyl butanoate.
| Compound Name | [(2R,3R,4S,5S,6S)-3,4,5-tri(butanoyloxy)-6-[(2S,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]oxan-2-yl]methyl butanoate |
|---|---|
| PubChem CID | 90111027 |
| Molecular Formula | C28H48O16 |
| Molecular Weight | 640.68 g/mol |
| Exact Mass | 640.29 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-3,4,5-tri(butanoyloxy)-6-[(2S,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]oxan-2-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[C@H]1O[C@@H](OC(O)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)[C@@H](OC(=O)CCC)[C@@H](OC(=O)CCC)[C@@H]1OC(=O)CCC |
| InChI | InChI=1S/C28H48O16/c1-5-9-17(31)39-14-16-24(41-18(32)10-6-2)25(42-19(33)11-7-3)26(43-20(34)12-8-4)28(40-16)44-27(38)23(37)22(36)21(35)15(30)13-29/h15-16,21-30,35-38H,5-14H2,1-4H3/t15-,16-,21-,22+,23+,24-,25+,26+,27?,28+/m1/s1 |
| InChIKey | AHQYBYATJMUARV-BTIBYNBVSA-N |
| XLogP | -1.04 |
| TPSA | 245.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.68 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|